For research use only. Not for therapeutic Use.
Proflavine（Cat No.:I044137）is an acridine dye with antiseptic and antimicrobial properties, historically used as a topical disinfectant and wound antiseptic. It intercalates into DNA, disrupting replication and transcription, which accounts for its antibacterial and mutagenic effects. Proflavine is particularly effective against Gram-positive bacteria and has been used in surgical and military settings. In research, it serves as a fluorescent nucleic acid stain and a model compound for studying DNA-ligand interactions. Its ability to bind DNA also makes it a useful tool in molecular biology, cytogenetics, and photodynamic therapy investigations.
| CAS Number | 92-62-6 |
| Synonyms | acridine-3,6-diamine |
| Molecular Formula | C13H11N3 |
| Purity | ≥95% |
| IUPAC Name | acridine-3,6-diamine |
| InChI | InChI=1S/C13H11N3/c14-10-3-1-8-5-9-2-4-11(15)7-13(9)16-12(8)6-10/h1-7H,14-15H2 |
| InChIKey | WDVSHHCDHLJJJR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=NC3=C(C=CC(=C3)N)C=C21)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
