For research use only. Not for therapeutic Use.
Procyanidin B4, (-)- (Cat.No:R074508), is a natural flavonoid compound found in various plants. It possesses antioxidant and anti-inflammatory properties and is associated with potential health benefits, including cardiovascular protection and anti-cancer effects. Procyanidin B4 is a subject of research for its therapeutic potential in various health conditions.
| CAS Number | 29106-51-2 |
| Molecular Formula | C30H26O12 |
| Purity | ≥95% |
| Target | Disease Research Fields |
| IUPAC Name | (2R,3R)-2-(3,4-dihydroxyphenyl)-8-[(2R,3S,4S)-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-4-yl]-3,4-dihydro-2H-chromene-3,5,7-triol |
| InChI | InChI=1S/C30H26O12/c31-13-7-20(37)24-23(8-13)41-29(12-2-4-16(33)19(36)6-12)27(40)26(24)25-21(38)10-17(34)14-9-22(39)28(42-30(14)25)11-1-3-15(32)18(35)5-11/h1-8,10,22,26-29,31-40H,9H2/t22-,26+,27+,28-,29-/m1/s1 |
| InChIKey | XFZJEEAOWLFHDH-VUGKQVTMSA-N |
| SMILES | C1C(C(OC2=C1C(=CC(=C2C3C(C(OC4=CC(=CC(=C34)O)O)C5=CC(=C(C=C5)O)O)O)O)O)C6=CC(=C(C=C6)O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |