For research use only. Not for therapeutic Use.
Procyanidin A1（Cat No.:R065928）is a dimeric flavanol belonging to the class of proanthocyanidins, composed of two epicatechin units linked via an A-type interflavan bond (2β→7 and 4β→8 ether linkage). Naturally found in cranberries, peanuts, and cinnamon, it exhibits potent antioxidant, anti-inflammatory, and antimicrobial properties. Procyanidin A1 has gained interest in nutraceutical and pharmaceutical research for its potential cardioprotective and anti-cancer effects. It also supports vascular health and inhibits bacterial adhesion. Its unique structure contributes to its stability and bioactivity, making it a valuable compound in functional food and biomedical applications.
| CAS Number | 103883-03-0 |
| Synonyms | (1R,5R,6S,13S,21R)-5,13-bis(3,4-dihydroxyphenyl)-4,12,14-trioxapentacyclo[11.7.1.02,11.03,8.015,20]henicosa-2(11),3(8),9,15,17,19-hexaene-6,9,17,19,21-pentol |
| Molecular Formula | C30H24O12 |
| Purity | ≥95% |
| IUPAC Name | (1R,5R,6S,13S,21R)-5,13-bis(3,4-dihydroxyphenyl)-4,12,14-trioxapentacyclo[11.7.1.02,11.03,8.015,20]henicosa-2(11),3(8),9,15,17,19-hexaene-6,9,17,19,21-pentol |
| InChI | InChI=1S/C30H24O12/c31-13-7-20(37)24-22(8-13)41-30(12-2-4-16(33)19(36)6-12)29(39)26(24)25-23(42-30)10-17(34)14-9-21(38)27(40-28(14)25)11-1-3-15(32)18(35)5-11/h1-8,10,21,26-27,29,31-39H,9H2/t21-,26+,27+,29+,30-/m0/s1 |
| InChIKey | NSEWTSAADLNHNH-TXZJYACMSA-N |
| SMILES | C1[C@@H]([C@H](OC2=C1C(=CC3=C2[C@@H]4[C@H]([C@](O3)(OC5=CC(=CC(=C45)O)O)C6=CC(=C(C=C6)O)O)O)O)C7=CC(=C(C=C7)O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
