For research use only. Not for therapeutic Use.
PRGL493（Cat No.:I035011）is a selective small-molecule antagonist of the prostaglandin E2 receptor EP4, a G protein-coupled receptor involved in inflammation, immune modulation, and tumor progression. By blocking EP4 signaling, PRGL493 inhibits downstream pathways such as cAMP production and immune-suppressive gene expression, thereby enhancing antitumor immune responses and reducing inflammation. It is particularly valuable in cancer immunotherapy research and studies of autoimmune and inflammatory diseases. PRGL493 supports therapeutic strategies aimed at modulating prostaglandin signaling to restore immune balance and limit disease progression in various pathological contexts.
| CAS Number | 2479378-45-3 |
| Synonyms | N-[4-[3-(5-methylfuran-2-yl)-1-phenylpyrazol-4-yl]-1,4-dihydro-[1,3,5]triazino[1,2-a]benzimidazol-2-yl]acetamide |
| Molecular Formula | C25H21N7O2 |
| Purity | ≥95% |
| IUPAC Name | N-[4-[3-(5-methylfuran-2-yl)-1-phenylpyrazol-4-yl]-1,4-dihydro-[1,3,5]triazino[1,2-a]benzimidazol-2-yl]acetamide |
| InChI | InChI=1S/C25H21N7O2/c1-15-12-13-21(34-15)22-18(14-31(30-22)17-8-4-3-5-9-17)23-28-24(26-16(2)33)29-25-27-19-10-6-7-11-20(19)32(23)25/h3-14,23H,1-2H3,(H2,26,27,28,29,33) |
| InChIKey | QNWGOBIYAPLFMK-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(O1)C2=NN(C=C2C3N=C(NC4=NC5=CC=CC=C5N34)NC(=O)C)C6=CC=CC=C6 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
