For research use only. Not for therapeutic Use.
PqsR/LasR-IN-2（Cat No.:I043695）is a potent inhibitor targeting the PqsR and LasR quorum-sensing receptors, which are critical regulators of virulence factor production in Pseudomonas aeruginosa, a pathogenic bacterium. By disrupting the communication between these receptors, PqsR/LasR-IN-2 reduces the expression of toxins and biofilm formation, impairing the bacterium’s ability to cause infection. This inhibitor offers a promising strategy to combat P. aeruginosa infections, particularly in cystic fibrosis and other chronic diseases, by targeting bacterial virulence without directly killing the bacteria, thereby reducing the risk of resistance development.
| CAS Number | 2071705-93-4 |
| Synonyms | (E)-1-[2-[2-(4-butan-2-ylphenoxy)ethoxy]-5-chlorophenyl]-N-(1,2,4-triazol-4-yl)methanimine |
| Molecular Formula | C21H23ClN4O2 |
| Purity | ≥95% |
| IUPAC Name | (E)-1-[2-[2-(4-butan-2-ylphenoxy)ethoxy]-5-chlorophenyl]-N-(1,2,4-triazol-4-yl)methanimine |
| InChI | InChI=1S/C21H23ClN4O2/c1-3-16(2)17-4-7-20(8-5-17)27-10-11-28-21-9-6-19(22)12-18(21)13-25-26-14-23-24-15-26/h4-9,12-16H,3,10-11H2,1-2H3/b25-13+ |
| InChIKey | DLQFXDYTUCWLFI-DHRITJCHSA-N |
| SMILES | CCC(C)C1=CC=C(C=C1)OCCOC2=C(C=C(C=C2)Cl)/C=N/N3C=NN=C3 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
