For research use only. Not for therapeutic Use.
PPIase-Parvulin inhibitor（Cat No.:I011775）is a compound that targets parvulin-type peptidylprolyl isomerases (PPIases), enzymes responsible for catalyzing the isomerization of proline residues in proteins, a crucial step in protein folding and function. By inhibiting PPIase-Parvulin activity, this inhibitor disrupts the proper folding and function of target proteins, affecting cellular processes such as signal transduction and stress responses. This inhibitor holds potential in research on protein folding diseases, cancer, and bacterial infections, as parvulins are involved in key cellular functions, making them attractive targets for therapeutic development.
| CAS Number | 64005-90-9 |
| Synonyms | ethyl 2-[13-(2-ethoxy-2-oxoethyl)-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl]acetate |
| Molecular Formula | C22H18N2O8 |
| Purity | ≥95% |
| IUPAC Name | ethyl 2-[13-(2-ethoxy-2-oxoethyl)-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl]acetate |
| InChI | InChI=1S/C22H18N2O8/c1-3-31-15(25)9-23-19(27)11-5-7-13-18-14(8-6-12(17(11)18)20(23)28)22(30)24(21(13)29)10-16(26)32-4-2/h5-8H,3-4,9-10H2,1-2H3 |
| InChIKey | WNKQGFNIIHNGQM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CN1C(=O)C2=C3C(=CC=C4C3=C(C=C2)C(=O)N(C4=O)CC(=O)OCC)C1=O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
