For research use only. Not for therapeutic Use.
| CAS Number | 36099-95-3 |
| Synonyms | 67: PN: EP2161028 PAGE: 10 claimed protein; 7: PN: JP2014079213 TABLE: 2 claimed sequence; G 3335; L-Tryptophyl-L-glutamic Acid; L-α-Tryptophanyl-L-glutamic Acid; Tryptophylglutamic Acid |
| Molecular Formula | C₁₆H₁₉N₃O₅ |
| Purity | ≥95% |
| Target | Vitamin D Related/Nuclear Receptor |
| Solubility | Soluble in DMSO |
| Storage | Store at -20°C |
| InChI | InChI=1S/C16H19N3O5/c17-11(7-9-8-18-12-4-2-1-3-10(9)12)15(22)19-13(16(23)24)5-6-14(20)21/h1-4,8,11,13,18H,5-7,17H2,(H,19,22)(H,20,21)(H,23,24) |
| InChIKey | PWIQCLSQVQBOQV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)CC(C(=O)NC(CCC(=O)O)C(=O)O)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |