For research use only. Not for therapeutic Use.
Potassium tetrakis[3,5-bis(trifluoromethyl)phenyl]borate(Cat No.:M005590) is a complex chemical compound featuring a boron center coordinated to four phenyl rings, each substituted with two trifluoromethyl groups at the 3 and 5 positions. This compound, often abbreviated as KTFPB, belongs to a class of weakly coordinating anions, known for their ability to stabilize highly reactive cations in various chemical environments. KTFPB is particularly valued in organometallic chemistry and catalysis for its role in facilitating reactions that require stable yet reactive intermediates. Its use enhances the precision and efficiency of synthesizing novel chemical structures and materials.
CAS Number | 105560-52-9 |
Molecular Formula | C32H12BF24K |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | potassium;tetrakis[3,5-bis(trifluoromethyl)phenyl]boranuide |
InChI | InChI=1S/C32H12BF24.K/c34-25(35,36)13-1-14(26(37,38)39)6-21(5-13)33(22-7-15(27(40,41)42)2-16(8-22)28(43,44)45,23-9-17(29(46,47)48)3-18(10-23)30(49,50)51)24-11-19(31(52,53)54)4-20(12-24)32(55,56)57;/h1-12H;/q-1;+1 |
InChIKey | DGEVYOMQOPNBCY-UHFFFAOYSA-N |
SMILES | [B-](C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F)(C2=CC(=CC(=C2)C(F)(F)F)C(F)(F)F)(C3=CC(=CC(=C3)C(F)(F)F)C(F)(F)F)C4=CC(=CC(=C4)C(F)(F)F)C(F)(F)F.[K+] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |