Potassium oxalate (Cat.No:R071250) is a salt composed of potassium ions and oxalate ions. It finds use in various industrial applications, including metal cleaning, photography, and as a reducing agent in chemical processes. Additionally, it has applications in certain analytical chemistry techniques.
Catalog Number | R071250 |
CAS Number | 6487-48-5 |
Synonyms | K2C2O4.H2O, Ethanedioic acid dipotassium salt monohydrate |
Molecular Formula | C2H2K2O5 |
Purity | 95% |
Storage | RT |
IUPAC Name | dipotassium;oxalate;hydrate |
InChI | InChI=1S/C2H2O4.2K.H2O/c3-1(4)2(5)6;;;/h(H,3,4)(H,5,6);;;1H2/q;2*+1;/p-2 |
InChIKey | QCPTVXCMROGZOL-UHFFFAOYSA-L |
SMILES | C(=O)(C(=O)[O-])[O-].O.[K+].[K+] |