For research use only. Not for therapeutic Use.
Poriol（Cat No.:M061581）is a flavonoid compound belonging to the flavanone subclass, naturally found in various plant species, including those in the Populus (poplar) genus. It exhibits a range of biological activities, notably antioxidant, anti-inflammatory, and antimicrobial effects. Poriol contributes to the plant’s defense mechanisms and has been studied for its ability to scavenge free radicals and modulate inflammatory signaling pathways. Due to its polyphenolic structure, it also shows potential in protecting against oxidative stress-related diseases. Poriol is of interest in phytochemical research and the development of natural therapeutic agents.
| CAS Number | 14348-16-4 |
| Synonyms | (2S)-5,7-dihydroxy-2-(4-hydroxyphenyl)-6-methyl-2,3-dihydrochromen-4-one |
| Molecular Formula | C16H14O5 |
| Purity | ≥95% |
| IUPAC Name | 5,7-dihydroxy-2-(4-hydroxyphenyl)-6-methyl-2,3-dihydrochromen-4-one |
| InChI | InChI=1S/C16H14O5/c1-8-11(18)6-14-15(16(8)20)12(19)7-13(21-14)9-2-4-10(17)5-3-9/h2-6,13,17-18,20H,7H2,1H3 |
| InChIKey | SLFZBNOERHGNMI-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C1O)OC(CC2=O)C3=CC=C(C=C3)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
