For research use only. Not for therapeutic Use.
Poricoic acid B（Cat No.:I018238）is a triterpenoid compound isolated from Poria cocos (Fu Ling), a traditional medicinal fungus widely used in East Asian herbal medicine. As a lanostane-type triterpenoid, it shows diverse pharmacological activities, including anti-inflammatory, antioxidant, and nephroprotective effects. Research indicates that poricoic acid B can modulate renal fibrosis pathways, regulate immune responses, and protect against oxidative stress, making it valuable for kidney health. Additionally, it contributes to the traditional diuretic and tonic functions of Poria cocos. Its broad therapeutic potential supports ongoing studies in nephrology and metabolic disease research.
| CAS Number | 137551-39-4 |
| Synonyms | (2R)-2-[(2R,3R,3aR,6S,7S,9bR)-6-(2-carboxyethyl)-2-hydroxy-3a,6,9b-trimethyl-7-prop-1-en-2-yl-1,2,3,4,7,8-hexahydrocyclopenta[a]naphthalen-3-yl]-6-methylhept-5-enoic acid |
| Molecular Formula | C30H44O5 |
| Purity | ≥95% |
| IUPAC Name | (2R)-2-[(2R,3R,3aR,6S,7S,9bR)-6-(2-carboxyethyl)-2-hydroxy-3a,6,9b-trimethyl-7-prop-1-en-2-yl-1,2,3,4,7,8-hexahydrocyclopenta[a]naphthalen-3-yl]-6-methylhept-5-enoic acid |
| InChI | InChI=1S/C30H44O5/c1-18(2)9-8-10-20(27(34)35)26-24(31)17-30(7)23-12-11-21(19(3)4)28(5,15-14-25(32)33)22(23)13-16-29(26,30)6/h9,12-13,20-21,24,26,31H,3,8,10-11,14-17H2,1-2,4-7H3,(H,32,33)(H,34,35)/t20-,21+,24-,26+,28+,29-,30+/m1/s1 |
| InChIKey | NXAZWYWJZDFISF-KXGBKNTBSA-N |
| SMILES | CC(=CCC[C@H]([C@H]1[C@@H](C[C@@]2([C@@]1(CC=C3C2=CC[C@H]([C@]3(C)CCC(=O)O)C(=C)C)C)C)O)C(=O)O)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
