For research use only. Not for therapeutic Use.
Poncirin(CAT: M059022) is a natural flavanone glycoside predominantly found in the fruits of Poncirus trifoliata and various citrus species. It has attracted interest for its broad pharmacological properties, including anti-inflammatory, antioxidant, anti-obesity, and anticancer effects. Research indicates that Poncirin can modulate metabolic pathways, improve lipid and glucose regulation, and inhibit inflammatory mediators, making it relevant for studies in cardiovascular and metabolic disorders. Additionally, it has shown potential in cancer research by suppressing tumor cell proliferation and inducing apoptosis. With its stable glycoside structure and diverse bioactivities, Poncirin serves as a valuable natural compound for therapeutic exploration in metabolic, inflammatory, and degenerative diseases.
| CAS Number | 14941-08-3 |
| Synonyms | (2S)-7-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-5-hydroxy-2-(4-methoxyphenyl)-2,3-dihydrochromen-4-one |
| Molecular Formula | C28H34O14 |
| Purity | ≥95% |
| IUPAC Name | (2S)-7-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-5-hydroxy-2-(4-methoxyphenyl)-2,3-dihydrochromen-4-one |
| InChI | InChI=1S/C28H34O14/c1-11-21(32)23(34)25(36)27(38-11)42-26-24(35)22(33)19(10-29)41-28(26)39-14-7-15(30)20-16(31)9-17(40-18(20)8-14)12-3-5-13(37-2)6-4-12/h3-8,11,17,19,21-30,32-36H,9-10H2,1-2H3/t11-,17-,19+,21-,22+,23+,24-,25+,26+,27-,28+/m0/s1 |
| InChIKey | NLAWPKPYBMEWIR-SKYQDXIQSA-N |
| SMILES | CC1C(C(C(C(O1)OC2C(C(C(OC2OC3=CC(=C4C(=O)CC(OC4=C3)C5=CC=C(C=C5)OC)O)CO)O)O)O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
