For research use only. Not for therapeutic Use.
Pomalidomide-PEG2-azide（Cat No.:I044662）is a bifunctional molecule combining pomalidomide, an immunomodulatory drug (IMiD), with a polyethylene glycol (PEG2) spacer ending in an azide group. This compound is primarily used in the development of PROTACs (proteolysis-targeting chimeras) and other targeted protein degradation technologies. The pomalidomide moiety binds cereblon (CRBN), an E3 ubiquitin ligase substrate receptor, facilitating the ubiquitination and degradation of linked target proteins. The azide functionality enables click chemistry for conjugation with alkyne-tagged molecules. Pomalidomide-PEG2-azide is a valuable tool in chemical biology and drug discovery for selective protein degradation studies.
| CAS Number | 2267306-14-7 |
| Synonyms | 2-[2-(2-azidoethoxy)ethoxy]-N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]acetamide |
| Molecular Formula | C19H20N6O7 |
| Purity | ≥95% |
| IUPAC Name | 2-[2-(2-azidoethoxy)ethoxy]-N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]acetamide |
| InChI | InChI=1S/C19H20N6O7/c20-24-21-6-7-31-8-9-32-10-15(27)22-12-3-1-2-11-16(12)19(30)25(18(11)29)13-4-5-14(26)23-17(13)28/h1-3,13H,4-10H2,(H,22,27)(H,23,26,28) |
| InChIKey | QMQAWNMGKYQDLT-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C(=CC=C3)NC(=O)COCCOCCN=[N+]=[N-] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
