For research use only. Not for therapeutic Use.
Pomalidomide-C2-NH2 hydrochloride（Cat No.:I018065）is a functionalized derivative of pomalidomide, an immunomodulatory imide drug (IMiD) known for its anti-proliferative, anti-angiogenic, and immunomodulatory activities. The compound incorporates a C2-amino linker, enabling conjugation or further modification for chemical biology and drug discovery applications. Supplied as the hydrochloride salt, it offers improved stability and handling in research settings. Pomalidomide-C2-NH2 hydrochloride is particularly valuable in the development of targeted protein degraders, such as PROTACs, where it serves as a CRBN-binding ligand to modulate ubiquitination and protein degradation pathways.
| CAS Number | 2305369-00-8 |
| Synonyms | 4-(2-aminoethylamino)-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione;hydrochloride |
| Molecular Formula | C15H17ClN4O4 |
| Purity | ≥95% |
| IUPAC Name | 4-(2-aminoethylamino)-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione;hydrochloride |
| InChI | InChI=1S/C15H16N4O4.ClH/c16-6-7-17-9-3-1-2-8-12(9)15(23)19(14(8)22)10-4-5-11(20)18-13(10)21;/h1-3,10,17H,4-7,16H2,(H,18,20,21);1H |
| InChIKey | DSJCOXQYDMWPEY-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C(=CC=C3)NCCN.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
