For research use only. Not for therapeutic Use.
Pomalidomide-6-OH（Cat No.:I044388）is a major hydroxylated metabolite of pomalidomide, an immunomodulatory drug (IMiD) used in the treatment of multiple myeloma and other hematologic malignancies. This metabolite retains biological activity, contributing to the overall pharmacodynamic effects of pomalidomide. Pomalidomide-6-OH modulates the immune system by enhancing T-cell and natural killer (NK) cell responses, while also promoting degradation of transcription factors via cereblon binding. Its presence in plasma helps in understanding pomalidomide’s metabolism, efficacy, and safety profile, making it a key analyte in pharmacokinetic and pharmacological studies of IMiD-based therapies.
| CAS Number | 1547162-44-6 |
| Synonyms | 4-amino-2-(2,6-dioxopiperidin-3-yl)-6-hydroxyisoindole-1,3-dione |
| Molecular Formula | C13H11N3O5 |
| Purity | ≥95% |
| IUPAC Name | 4-amino-2-(2,6-dioxopiperidin-3-yl)-6-hydroxyisoindole-1,3-dione |
| InChI | InChI=1S/C13H11N3O5/c14-7-4-5(17)3-6-10(7)13(21)16(12(6)20)8-1-2-9(18)15-11(8)19/h3-4,8,17H,1-2,14H2,(H,15,18,19) |
| InChIKey | HBPNHPWPUQVWIY-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C(=CC(=C3)O)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
