For research use only. Not for therapeutic Use.
Pomalidomide-5′-PEG5-C2-COOH(Cat No.:I042314)is a modified form of pomalidomide, an immunomodulatory drug used in the treatment of multiple myeloma. The modification involves the addition of a polyethylene glycol (PEG) chain and a carboxylic acid group, enhancing the drug’s pharmacokinetic properties, such as solubility and stability. This modification may also improve the compound’s ability to target specific cells or tissues more effectively. Pomalidomide itself works by modulating the immune system, enhancing anti-tumor activity. Research is ongoing to assess the modified version’s safety, efficacy, and potential therapeutic advantages in treating cancer and immune-related diseases.
| CAS Number | 2412056-50-7 |
| Synonyms | 3-[2-[2-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| Molecular Formula | C26H35N3O11 |
| Purity | ≥95% |
| IUPAC Name | 3-[2-[2-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChI | InChI=1S/C26H35N3O11/c30-22-4-3-21(24(33)28-22)29-25(34)19-2-1-18(17-20(19)26(29)35)27-6-8-37-10-12-39-14-16-40-15-13-38-11-9-36-7-5-23(31)32/h1-2,17,21,27H,3-16H2,(H,31,32)(H,28,30,33) |
| InChIKey | VQDMIMQNZYRLNF-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C=C(C=C3)NCCOCCOCCOCCOCCOCCC(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |