For research use only. Not for therapeutic Use.
Pomalidomide 4′-alkylC5-acid (Example 3) is an E3 ligase ligand-linker conjugate containing a Pomalidomide (HY-10984) based cereblon (CRBN) ligand and a linker. Pomalidomide 4′-alkylC5-acid can be used in the synthesis of PROTAC[1].
| CAS Number | 2225940-49-6 |
| Synonyms | 6-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]hexanoic acid |
| Molecular Formula | C19H21N3O6 |
| Purity | ≥95% |
| InChI | InChI=1S/C19H21N3O6/c23-14-9-8-13(17(26)21-14)22-18(27)11-5-4-6-12(16(11)19(22)28)20-10-3-1-2-7-15(24)25/h4-6,13,20H,1-3,7-10H2,(H,24,25)(H,21,23,26) |
| InChIKey | FOHDGJCYBZWKCE-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C(=CC=C3)NCCCCCC(=O)O |
| Reference | [1]. Jian Jin, et al. Compositions and methods for treating cdk4/6-mediated cancer. Patent WO2018106870A1. |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |