Poly(N-isopropylacrylamide) (PNiPAM)（Cat No.:M000068）, is a temperature-responsive polymer with a wide range of applications in science and industry. At lower temperatures, PNiPAM is hydrophilic and water-soluble, but as the temperature increases, it becomes hydrophobic and precipitates out of the solution. This unique property has led to its use in drug delivery systems, tissue engineering, and smart materials. PNiPAM can form temperature-sensitive gels, making it valuable in controlled drug release and tissue culture.
| Catalog Number | M000068 |
| CAS Number | 25189-55-3 |
| Synonyms | N-ISO-PROPYLACRYLAMIDE POLYMER;POLY(N-ISOPROPYL ACRYLAMIDE);2-Propenamide,N-(1-methylethyl)-,homopolymer;n-(1-methylethyl)-2-propenamidhomopolymer;poly(n-iso-propylacrylamide)(mw20000-25000);nipam polymer;2-Propenamid, N-(1-methylethyl)-, Homopolymer |
| Molecular Formula | C6H11NO |
| Purity | 0% |
| Solubility | Soluble In THF, dioxane, DMF, cold water, chloroform |
| Storage | -20°C |
| Related CAS | 192708-92-2 |
| IUPAC Name | N-propan-2-ylprop-2-enamide |
| InChI | InChI=1S/C6H11NO/c1-4-6(8)7-5(2)3/h4-5H,1H2,2-3H3,(H,7,8) |
| InChIKey | QNILTEGFHQSKFF-UHFFFAOYSA-N |
| SMILES | CC(C)NC(=O)C=C |
| Reference | 1: Igwe IE, Zong Y, Yang X, Ouyang Z, Chen K. Induced Attraction between |
