For research use only. Not for therapeutic Use.
PolQi2(CAT: I040795) is a small-molecule inhibitor that selectively targets DNA polymerase theta (Polθ), an enzyme involved in the microhomology-mediated end joining (MMEJ) DNA repair pathway. Polθ plays a crucial role in repairing double-strand breaks, particularly in cells deficient in homologous recombination (HR), such as those with BRCA1/2 mutations. By inhibiting Polθ, PolQi2 enhances genomic instability in HR-deficient cancer cells, leading to synthetic lethality and selective tumor cell death. PolQi2 is a valuable tool for studying DNA repair mechanisms and is being explored for its potential in targeted cancer therapies, especially in combination with PARP inhibitors for enhanced efficacy.
| CAS Number | 2565638-16-4 |
| Synonyms | N-[5-[(5-chloropyridin-2-yl)methoxy]-1,3,4-thiadiazol-2-yl]-3-(2-methoxyphenyl)pyridine-4-carboxamide |
| Molecular Formula | C21H16ClN5O3S |
| Purity | ≥95% |
| IUPAC Name | N-[5-[(5-chloropyridin-2-yl)methoxy]-1,3,4-thiadiazol-2-yl]-3-(2-methoxyphenyl)pyridine-4-carboxamide |
| InChI | InChI=1S/C21H16ClN5O3S/c1-29-18-5-3-2-4-15(18)17-11-23-9-8-16(17)19(28)25-20-26-27-21(31-20)30-12-14-7-6-13(22)10-24-14/h2-11H,12H2,1H3,(H,25,26,28) |
| InChIKey | REZMONWROTVQHG-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC=C1C2=C(C=CN=C2)C(=O)NC3=NN=C(S3)OCC4=NC=C(C=C4)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
