For research use only. Not for therapeutic Use.
Podophyllotoxone（Cat No.:R042076）is a naturally derived aryltetralin lignan structurally related to podophyllotoxin, isolated from Podophyllum species. It exhibits notable cytotoxic and antimitotic activity through the inhibition of microtubule assembly, leading to cell cycle arrest. As a core scaffold, podophyllotoxone serves as a precursor for the development of semi-synthetic anticancer agents, including topoisomerase II inhibitors like etoposide. Its structural versatility and bioactivity make it valuable for medicinal chemistry research, particularly in cancer drug discovery, mechanistic studies, and natural product pharmacology.
| CAS Number | 477-49-6 |
| Synonyms | (5aR,8aR,9R)-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-[2]benzofuro[5,6-f][1,3]benzodioxole-5,8-dione |
| Molecular Formula | C22H20O8 |
| Purity | ≥95% |
| IUPAC Name | (5aR,8aR,9R)-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-[2]benzofuro[5,6-f][1,3]benzodioxole-5,8-dione |
| InChI | InChI=1S/C22H20O8/c1-25-16-4-10(5-17(26-2)21(16)27-3)18-11-6-14-15(30-9-29-14)7-12(11)20(23)13-8-28-22(24)19(13)18/h4-7,13,18-19H,8-9H2,1-3H3/t13-,18+,19-/m0/s1 |
| InChIKey | ISCQYPPCSYRZOT-BKTGTZMESA-N |
| SMILES | COC1=CC(=CC(=C1OC)OC)[C@H]2[C@@H]3[C@H](COC3=O)C(=O)C4=CC5=C(C=C24)OCO5 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
