Podocarpic acid (CAT: I004228) is a naturally occurring compound that exhibits a wide range of positive effects. It is recognized as a novel activator of the TRPA1 (Transient Receptor Potential Ankyrin 1) channel. TRPA1 is a sensory receptor involved in pain and inflammation pathways. Podocarpic acid’s activation of TRPA1 suggests its potential in modulating pain perception and inflammatory responses. As a natural product, podocarpic acid holds promise as a valuable compound for further investigation and development in the field of pain management and potentially other therapeutic applications.
Catalog Number | I004228 |
CAS Number | 5947-49-9 |
Synonyms | 12-hydroxypodocarpa-8,11,13-trien-16-oic acid; |
Molecular Formula | C17H22O3 |
Purity | 95% |
Target | TRPA1 |
Solubility | DMSO |
Storage | Room temperature |
IUPAC Name | (1S,4aS,10aR)-6-hydroxy-1,4a-dimethyl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid |
InChI | InChI=1S/C17H22O3/c1-16-8-3-9-17(2,15(19)20)14(16)7-5-11-4-6-12(18)10-13(11)16/h4,6,10,14,18H,3,5,7-9H2,1-2H3,(H,19,20)/t14-,16-,17+/m1/s1 |
InChIKey | VJILEYKNALCDDV-OIISXLGYSA-N |
SMILES | CC12CCCC(C1CCC3=C2C=C(C=C3)O)(C)C(=O)O |
Reference | <p style=”/line-height:25px/”> |