For research use only. Not for therapeutic Use.
Podecdysone B(CAT: I016764) is a naturally occurring phytoecdysteroid, a class of steroidal compounds structurally related to insect molting hormones. Isolated from certain plant species, it is studied for its potential roles in cellular growth regulation, metabolic modulation, and stress resistance. Researchers are particularly interested in its bioactivity in metabolic and endocrinology fields, where it shows promise for investigating energy balance, glucose handling, and muscle physiology. Podecdysone B is also being explored in rare disease and natural product chemistry research as a unique scaffold for drug discovery. It offers a valuable tool for probing steroid signaling pathways in biomedical studies.
| CAS Number | 22612-27-7 |
| Synonyms | (2S,3R,5R,10S,13R,17S)-2,3-dihydroxy-10,13-dimethyl-17-[(2R,3R)-2,3,6-trihydroxy-6-methylheptan-2-yl]-1,2,3,4,5,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-6-one |
| Molecular Formula | C27H42O6 |
| Purity | ≥95% |
| IUPAC Name | (2S,3R,5R,10S,13R,17S)-2,3-dihydroxy-10,13-dimethyl-17-[(2R,3R)-2,3,6-trihydroxy-6-methylheptan-2-yl]-1,2,3,4,5,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-6-one |
| InChI | InChI=1S/C27H42O6/c1-24(2,32)10-9-23(31)27(5,33)22-7-6-16-15-12-19(28)18-13-20(29)21(30)14-26(18,4)17(15)8-11-25(16,22)3/h6,18,20-23,29-33H,7-14H2,1-5H3/t18-,20+,21-,22-,23+,25-,26+,27+/m0/s1 |
| InChIKey | AEFMTBQZWMUASH-IILZZRPCSA-N |
| SMILES | CC12CCC3=C(C1=CCC2C(C)(C(CCC(C)(C)O)O)O)CC(=O)C4C3(CC(C(C4)O)O)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
