For research use only. Not for therapeutic Use.
Pociredir (Cat No.:I044412) is a potent, selective Toll-like receptor 8 (TLR8) agonist developed to enhance innate immune responses. It activates monocytes and dendritic cells, inducing pro-inflammatory cytokines such as TNF-α and IL-12, which are crucial for antiviral and antitumor immunity. Pociredir is primarily studied for its potential in treating chronic hepatitis B by stimulating immune-mediated clearance of infected cells. It also holds promise in cancer immunotherapy by promoting a robust immune microenvironment. Its oral bioavailability and targeted mechanism make it valuable in translational immunology research.
| CAS Number | 2490676-18-9 |
| Synonyms | (15R)-21-fluoro-10-(2-methylpyridin-3-yl)-13,17-dioxa-3,5,7,8-tetrazapentacyclo[13.6.1.04,12.05,9.018,22]docosa-1(21),4(12),6,8,10,18(22),19-heptaene |
| Molecular Formula | C22H18FN5O2 |
| Purity | ≥95% |
| IUPAC Name | (15R)-21-fluoro-10-(2-methylpyridin-3-yl)-13,17-dioxa-3,5,7,8-tetrazapentacyclo[13.6.1.04,12.05,9.018,22]docosa-1(21),4(12),6,8,10,18(22),19-heptaene |
| InChI | InChI=1S/C22H18FN5O2/c1-12-14(3-2-6-24-12)15-7-19-22(28-11-26-27-21(15)28)25-8-16-17(23)4-5-18-20(16)13(9-29-18)10-30-19/h2-7,11,13,25H,8-10H2,1H3/t13-/m1/s1 |
| InChIKey | JQBUTSBIFNKJMW-CYBMUJFWSA-N |
| SMILES | CC1=C(C=CC=N1)C2=CC3=C(NCC4=C(C=CC5=C4[C@H](CO5)CO3)F)N6C2=NN=C6 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
