For research use only. Not for therapeutic Use.
Pneumocandin B0 (Cat No.:I001378) is a lipopeptide antifungal agent belonging to the echinocandin class. It is derived from the fermentation of the fungus Glarea lozoyensis. Pneumocandin B0 inhibits the synthesis of beta-(1,3)-D-glucan, an essential component of the fungal cell wall. By targeting this key component, it disrupts the integrity and function of the fungal cell wall, leading to cell lysis and ultimately the death of the fungal cells. Pneumocandin B0 is primarily used as a therapeutic agent for the treatment of invasive fungal infections, particularly those caused by Candida species. Its mechanism of action and specificity for fungal cells make it an effective and important tool in the management of serious fungal infections.
| CAS Number | 135575-42-7 |
| Synonyms | L 688786; L688786; L-688786 |
| Molecular Formula | C50H80N8O17 |
| Purity | ≥95% |
| Target | Fungal |
| Solubility | 10 mM in DMSO |
| Storage | -20°C |
| IUPAC Name | (10R,12S)-N-[(3S,6S,9S,11R,15S,18S,20R,21R,24S,25S)-3-[(1R)-3-amino-1-hydroxy-3-oxopropyl]-6-[(1S,2S)-1,2-dihydroxy-2-(4-hydroxyphenyl)ethyl]-11,20,21,25-tetrahydroxy-15-[(1R)-1-hydroxyethyl]-2,5,8,14,17,23-hexaoxo-1,4,7,13,16,22-hexazatricyclo[22.3.0.09,13]heptacosan-18-yl]-10,12-dimethyltetradecanamide |
| InChI | InChI=1S/C50H80N8O17/c1-5-25(2)20-26(3)12-10-8-6-7-9-11-13-37(66)52-31-22-35(64)46(71)56-48(73)41-33(62)18-19-57(41)50(75)39(34(63)23-36(51)65)54-47(72)40(43(68)42(67)28-14-16-29(60)17-15-28)55-45(70)32-21-30(61)24-58(32)49(74)38(27(4)59)53-44(31)69/h14-17,25-27,30-35,38-43,46,59-64,67-68,71H,5-13,18-24H2,1-4H3,(H2,51,65)(H,52,66)(H,53,69)(H,54,72)(H,55,70)(H,56,73)/t25-,26+,27+,30+,31-,32-,33-,34+,35+,38-,39-,40-,41-,42-,43-,46+/m0/s1 |
| InChIKey | DQXPFAADCTZLNL-FXDJFZINSA-N |
| SMILES | CC[C@H](C)C[C@H](C)CCCCCCCCC(=O)N[C@H]1C[C@H]([C@H](NC(=O)[C@@H]2[C@H](CCN2C(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H]3C[C@H](CN3C(=O)[C@@H](NC1=O)[C@@H](C)O)O)[C@@H]([C@H](C4=CC=C(C=C4)O)O)O)[C@@H](CC(=O)N)O)O)O)O |
| Reference | <p> |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |