For research use only. Not for therapeutic Use.
PKRA83（Cat No.:I043668）is a selective inhibitor of protein kinase R (PKR), an enzyme involved in cellular stress responses, antiviral defense, and inflammation. PKRA83 works by blocking the activation of PKR, which is typically triggered by double-stranded RNA, and prevents its downstream effects, including inhibition of protein synthesis and induction of apoptosis. This inhibitor has potential therapeutic applications in treating viral infections, autoimmune disorders, and neurodegenerative diseases, where PKR activation plays a pathological role. PKRA83 is a valuable tool in research exploring the regulation of PKR and its involvement in various disease mechanisms.
| CAS Number | 1233926-87-8 |
| Synonyms | (3R)-N-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-1-[(4-fluoro-3-methoxyphenyl)methyl]-N-(2-methylpropyl)pyrrolidine-3-carboxamide |
| Molecular Formula | C27H34ClFN2O4 |
| Purity | ≥95% |
| IUPAC Name | (3R)-N-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-1-[(4-fluoro-3-methoxyphenyl)methyl]-N-(2-methylpropyl)pyrrolidine-3-carboxamide |
| InChI | InChI=1S/C27H34ClFN2O4/c1-18(2)14-31(16-20-11-22(28)26-25(13-20)34-9-4-10-35-26)27(32)21-7-8-30(17-21)15-19-5-6-23(29)24(12-19)33-3/h5-6,11-13,18,21H,4,7-10,14-17H2,1-3H3/t21-/m1/s1 |
| InChIKey | GZHUKRDKTDCKQD-OAQYLSRUSA-N |
| SMILES | CC(C)CN(CC1=CC2=C(C(=C1)Cl)OCCCO2)C(=O)[C@@H]3CCN(C3)CC4=CC(=C(C=C4)F)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
