For research use only. Not for therapeutic Use.
PKR Activator 4(Cat No.:I041289)is a small molecule compound designed to activate the protein kinase R (PKR), an enzyme involved in cellular stress response and immune regulation. PKR is typically activated by double-stranded RNA, leading to inhibition of protein synthesis and initiation of apoptosis. PKR Activator 4 selectively enhances PKR activation, which has potential therapeutic applications in antiviral, anticancer, and neurodegenerative disease treatments. By modulating the PKR pathway, it may help control abnormal cell proliferation or viral replication. Research is ongoing to assess its efficacy and safety in various disease models.
| CAS Number | 2283420-05-1 |
| Synonyms | 7-methyl-4-[[1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]methyl]-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one |
| Molecular Formula | C18H24N6O2SSi |
| Purity | ≥95% |
| IUPAC Name | 7-methyl-4-[[1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]methyl]-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one |
| InChI | InChI=1S/C18H24N6O2SSi/c1-23-15-13(10-19-21-18(15)25)16-17(23)20-14(27-16)9-12-5-6-24(22-12)11-26-7-8-28(2,3)4/h5-6,10H,7-9,11H2,1-4H3,(H,21,25) |
| InChIKey | OJINPWVFOQGLEV-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=NNC2=O)C3=C1N=C(S3)CC4=NN(C=C4)COCC[Si](C)(C)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |