For research use only. Not for therapeutic Use.
PKM2 Activator 2(Cat No.:I042927)is a small molecule designed to activate pyruvate kinase M2 (PKM2), an enzyme involved in regulating cellular metabolism, particularly in cancer cells. By stimulating PKM2 activity, this activator promotes enhanced glycolysis and supports the metabolic shift observed in rapidly proliferating cancer cells. PKM2 Activator 2 has potential therapeutic applications in oncology, where targeting tumor metabolism can inhibit cancer cell growth and survival. It may serve as a promising lead compound for developing novel cancer therapies aimed at metabolic reprogramming.
| CAS Number | 1186660-06-9 |
| Synonyms | 1-(2,6-difluorophenyl)sulfonyl-4-naphthalen-2-ylsulfonylpiperazine |
| Molecular Formula | C20H18F2N2O4S2 |
| Purity | ≥95% |
| IUPAC Name | 1-(2,6-difluorophenyl)sulfonyl-4-naphthalen-2-ylsulfonylpiperazine |
| InChI | InChI=1S/C20H18F2N2O4S2/c21-18-6-3-7-19(22)20(18)30(27,28)24-12-10-23(11-13-24)29(25,26)17-9-8-15-4-1-2-5-16(15)14-17/h1-9,14H,10-13H2 |
| InChIKey | LLOHMBFPOYWAIL-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1S(=O)(=O)C2=CC3=CC=CC=C3C=C2)S(=O)(=O)C4=C(C=CC=C4F)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |