For research use only. Not for therapeutic Use.
PIT-1（Cat No.:I010676）, also known as POU1F1, is a pituitary-specific transcription factor essential for the development and function of the anterior pituitary gland. It regulates the expression of growth hormone (GH), prolactin (PRL), and thyroid-stimulating hormone (TSH). Mutations in the PIT-1 gene can result in combined pituitary hormone deficiency (CPHD), leading to growth failure, hypothyroidism, and reproductive issues. PIT-1 plays a pivotal role in lineage differentiation of somatotrophs, lactotrophs, and thyrotrophs. Its function is crucial for endocrine system homeostasis, and it is studied in both developmental biology and endocrinology research.
| CAS Number | 53501-41-0 |
| Synonyms | N-[(3-chloro-2-hydroxy-5-nitrophenyl)carbamothioyl]benzamide |
| Molecular Formula | C14H10ClN3O4S |
| Purity | ≥95% |
| IUPAC Name | N-[(3-chloro-2-hydroxy-5-nitrophenyl)carbamothioyl]benzamide |
| InChI | InChI=1S/C14H10ClN3O4S/c15-10-6-9(18(21)22)7-11(12(10)19)16-14(23)17-13(20)8-4-2-1-3-5-8/h1-7,19H,(H2,16,17,20,23) |
| InChIKey | RIGXBXPAOGDDIG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NC(=S)NC2=C(C(=CC(=C2)[N+](=O)[O-])Cl)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
