For research use only. Not for therapeutic Use.
Piroctone Olamine (Cat No.:R060834) is an antifungal and antibacterial agent with potential pharmaceutical and cosmetic applications. It primarily targets and inhibits the growth of fungi, particularly the Malassezia species, and certain bacteria. Its mode of action involves disrupting the cell membranes and inhibiting enzymes essential for the microorganisms’ survival. Pharmacologically, Piroctone Olamine demonstrates antifungal and antibacterial properties, making it effective in treating dandruff, seborrheic dermatitis, and other fungal or bacterial skin conditions. Additionally, it is utilized in various cosmetic products, such as shampoos and skin care formulations, for its antimicrobial and preservative functions.
CAS Number | 68890-66-4 |
Synonyms | 2-Aminoethanol, compd. with 1-Hydroxy-4-methyl-6-(2,4,4-trimethylpentyl)-2(1H)-pyridinone; 1-Hydroxy-4-methyl-6-(2,4,4-trimethylpentyl)-2-pyridone monoethanolamine Salt; Octopirox; Octopyrox; Piroctone Ethanolamine Salt; |
Molecular Formula | C₁₆H₃₀N₂O₃ |
Purity | ≥95% |
Target | Fungal |
Storage | Store at -20°C |
IUPAC Name | 2-aminoethanol;1-hydroxy-4-methyl-6-(2,4,4-trimethylpentyl)pyridin-2-one |
InChI | InChI=1S/C14H23NO2.C2H7NO/c1-10-6-12(15(17)13(16)8-10)7-11(2)9-14(3,4)5;3-1-2-4/h6,8,11,17H,7,9H2,1-5H3;4H,1-3H2 |
InChIKey | BTSZTGGZJQFALU-UHFFFAOYSA-N |
SMILES | CC1=CC(=O)N(C(=C1)CC(C)CC(C)(C)C)O.C(CO)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |