Piribedil D8(Cat No.: I001522) is a deuterium-labeled form of piribedil. Piribedil is an antiparkinsonian agent that is used in the treatment of Parkinson’s disease and other related movement disorders. It acts as a dopamine agonist, stimulating dopamine receptors in the brain and helping to alleviate the motor symptoms associated with Parkinson’s disease, such as tremors, rigidity, and bradykinesia. The deuterium-labeled form, Piribedil D8, is used in research and clinical studies to track the pharmacokinetics and metabolism of piribedil in the body. By replacing hydrogen atoms with deuterium atoms, the labeled compound can provide valuable insights into the drug’s absorption, distribution, and elimination pathways.
| Catalog Number | I001522 |
| CAS Number | 1398044-45-5 |
| Synonyms | ET-495 D8 |
| Molecular Formula | C16H10D8N4O2 |
| Purity | 95% |
| Solubility | 10 mM in DMSO |
| Storage | 3 years -20C powder |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-2,2,3,3,5,5,6,6-octadeuterio-4-pyrimidin-2-ylpiperazine |
| InChI | InChI=1S/C16H18N4O2/c1-4-17-16(18-5-1)20-8-6-19(7-9-20)11-13-2-3-14-15(10-13)22-12-21-14/h1-5,10H,6-9,11-12H2/i6D2,7D2,8D2,9D2 |
| InChIKey | OQDPVLVUJFGPGQ-COMRDEPKSA-N |
| SMILES | [2H]C1(C(N(C(C(N1CC2=CC3=C(C=C2)OCO3)([2H])[2H])([2H])[2H])C4=NC=CC=N4)([2H])[2H])[2H] |
