For research use only. Not for therapeutic Use.
Pipazethate（Cat No.:I008771）is a pharmaceutical compound primarily used as a bronchodilator and respiratory stimulant. It works by relaxing the smooth muscles of the airways, making it easier to breathe in conditions like asthma or chronic obstructive pulmonary disease (COPD). As a stimulant, it can help improve airflow and alleviate symptoms such as wheezing and shortness of breath. While it has been used in some countries, it is less common today due to the development of newer respiratory medications. Its effectiveness and safety are well-established in specific therapeutic contexts.
| CAS Number | 2167-85-3 |
| Synonyms | 2-(2-piperidin-1-ylethoxy)ethyl pyrido[3,2-b][1,4]benzothiazine-10-carboxylate |
| Molecular Formula | C21H25N3O3S |
| Purity | ≥95% |
| IUPAC Name | 2-(2-piperidin-1-ylethoxy)ethyl pyrido[3,2-b][1,4]benzothiazine-10-carboxylate |
| InChI | InChI=1S/C21H25N3O3S/c25-21(27-16-15-26-14-13-23-11-4-1-5-12-23)24-17-7-2-3-8-18(17)28-19-9-6-10-22-20(19)24/h2-3,6-10H,1,4-5,11-16H2 |
| InChIKey | DTVJXCOMJLLMAK-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)CCOCCOC(=O)N2C3=CC=CC=C3SC4=C2N=CC=C4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
