For research use only. Not for therapeutic Use.
(-)-Pinoresinol is a lignan compound found in various plants, including flaxseed, sesame seeds, and pine trees. This natural product exhibits antioxidant and anti-inflammatory properties, making it potentially beneficial for human health. (-)-Pinoresinol is known for its role as a phytoestrogen, interacting with estrogen receptors and influencing hormone-related processes. Research suggests that it may have cardiovascular protective effects and contribute to overall well-being. (-)-Pinoresinol’s presence in dietary sources underscores its potential as a bioactive compound with implications for nutrition and preventive health strategies.
| CAS Number | 81446-29-9 |
| Molecular Formula | C20H22O6 |
| Purity | ≥95% |
| Storage | Store at -20°C |
| IUPAC Name | 4-[(3R,3aS,6R,6aS)-6-(4-hydroxy-3-methoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-3-yl]-2-methoxyphenol |
| InChI | InChI=1S/C20H22O6/c1-23-17-7-11(3-5-15(17)21)19-13-9-26-20(14(13)10-25-19)12-4-6-16(22)18(8-12)24-2/h3-8,13-14,19-22H,9-10H2,1-2H3/t13-,14-,19+,20+/m1/s1 |
| InChIKey | HGXBRUKMWQGOIE-NSMLZSOPSA-N |
| SMILES | COC1=C(C=CC(=C1)C2C3COC(C3CO2)C4=CC(=C(C=C4)O)OC)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |