Picropodophyllotoxin (Cat.No:I003667) is a naturally occurring compound derived from the plant family Berberidaceae. It exhibits anticancer properties and has been studied for its potential in chemotherapy. Picropodophyllotoxin inhibits cell division by targeting microtubules and has shown activity against various cancer cell lines. Further research is ongoing to explore its therapeutic applications in cancer treatment.
| Catalog Number | I003667 |
| CAS Number | 477-47-4 |
| Synonyms | (5R,5aR,8aS,9R)-5-hydroxy-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-8-one |
| Molecular Formula | C₂₂H₂₂O₈ |
| Purity | 95% |
| Target | IGF1R |
| Solubility | in DMSO > 10 mM |
| Storage | Store at -20°C |
| IC50 | 1 nM(IGF1R autophosphorylation) |
| IUPAC Name | (5R,5aR,8aS,9R)-5-hydroxy-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-8-one |
| InChI | InChI=1S/C22H22O8/c1-25-16-4-10(5-17(26-2)21(16)27-3)18-11-6-14-15(30-9-29-14)7-12(11)20(23)13-8-28-22(24)19(13)18/h4-7,13,18-20,23H,8-9H2,1-3H3/t13-,18+,19+,20-/m0/s1 |
| InChIKey | YJGVMLPVUAXIQN-HAEOHBJNSA-N |
| SMILES | COC1=CC(=CC(=C1OC)OC)C2C3C(COC3=O)C(C4=CC5=C(C=C24)OCO5)O |
