For research use only. Not for therapeutic Use.
Picropodophyllone（Cat No.:I044880）is a naturally occurring aryltetralin lignan structurally related to podophyllotoxin, typically isolated from plants in the Podophyllum or related species. It features a trans-lactone configuration and multiple hydroxyl groups, contributing to its unique stereochemistry and biological activity. Picropodophyllone exhibits cytotoxic and antimitotic properties, interfering with microtubule dynamics and cell cycle progression, similar to other podophyllotoxin analogs. It is studied for its potential in anticancer drug development, especially as a precursor or template for semisynthetic derivatives. Its bioactivity also includes antiviral and anti-inflammatory effects in preclinical models.
| CAS Number | 477-48-5 |
| Synonyms | (5aR,8aS,9R)-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-[2]benzofuro[5,6-f][1,3]benzodioxole-5,8-dione |
| Molecular Formula | C22H20O8 |
| Purity | ≥95% |
| IUPAC Name | (5aR,8aS,9R)-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-[2]benzofuro[5,6-f][1,3]benzodioxole-5,8-dione |
| InChI | InChI=1S/C22H20O8/c1-25-16-4-10(5-17(26-2)21(16)27-3)18-11-6-14-15(30-9-29-14)7-12(11)20(23)13-8-28-22(24)19(13)18/h4-7,13,18-19H,8-9H2,1-3H3/t13-,18+,19+/m0/s1 |
| InChIKey | ISCQYPPCSYRZOT-MJXNMMHHSA-N |
| SMILES | COC1=CC(=CC(=C1OC)OC)[C@H]2[C@H]3[C@H](COC3=O)C(=O)C4=CC5=C(C=C24)OCO5 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
