For research use only. Not for therapeutic Use.
Picromycin(Cat No.:M013744)is a macrolide antibiotic produced by Streptomyces venezuelae. It exhibits antibacterial activity by inhibiting bacterial protein synthesis, targeting the 50S ribosomal subunit. Picromycin is particularly effective against Gram-positive bacteria and serves as a precursor to developing other macrolides due to its versatile structure. Its biosynthetic pathway has been extensively studied, providing insights into polyketide synthesis and enzymatic tailoring. While its clinical use is limited, picromycin remains valuable in antibiotic research, inspiring new derivatives and enhancing understanding of macrolide biosynthesis for therapeutic advancements.
| CAS Number | 19721-56-3 |
| Molecular Formula | C28H47NO8 |
| Purity | ≥95% |
| Target | Antibiotic |
| Storage | -20°C |
| IUPAC Name | (3R,5R,6S,7S,9R,11E,13S,14R)-6-[(2S,3R,4S,6R)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-14-ethyl-13-hydroxy-3,5,7,9,13-pentamethyl-1-oxacyclotetradec-11-ene-2,4,10-trione |
| InChI | InChI=1S/C28H47NO8/c1-10-22-28(7,34)12-11-21(30)15(2)13-16(3)25(18(5)23(31)19(6)26(33)36-22)37-27-24(32)20(29(8)9)14-17(4)35-27/h11-12,15-20,22,24-25,27,32,34H,10,13-14H2,1-9H3/b12-11+/t15-,16+,17-,18+,19-,20+,22-,24-,25+,27+,28+/m1/s1 |
| InChIKey | UZQBOFAUUTZOQE-VSLWXVDYSA-N |
| SMILES | CC[C@@H]1[C@@](/C=C/C(=O)[C@@H](C[C@@H]([C@@H]([C@H](C(=O)[C@H](C(=O)O1)C)C)O[C@H]2[C@@H]([C@H](C[C@H](O2)C)N(C)C)O)C)C)(C)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |