Picric acid (Cat.No:R069657) is a chemical compound known for its explosive properties and use as a yellow dye. When water is added to picric acid, it becomes less sensitive to shock and friction, reducing its explosive potential. It has applications in chemical analysis and as a dye in the textile industry.
Catalog Number | R069657 |
CAS Number | 88-89-1 |
Synonyms | C.I.# 10305, 2.4.6-Trinitrophenol |
Molecular Formula | C6H2(NO2)3OH |
Purity | 95% |
Storage | RT |
IUPAC Name | 2,4,6-trinitrophenol |
InChI | InChI=1S/C6H3N3O7/c10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h1-2,10H |
InChIKey | OXNIZHLAWKMVMX-UHFFFAOYSA-N |
SMILES | C1=C(C=C(C(=C1[N+](=O)[O-])O)[N+](=O)[O-])[N+](=O)[O-] |