For research use only. Not for therapeutic Use.
piCRAC-1（Cat No.:I043671）is a selective inhibitor of the CRAC (calcium release-activated calcium) channel, a key regulator of intracellular calcium levels, which plays a crucial role in immune cell activation and function. By inhibiting the CRAC channel, piCRAC-1 modulates calcium influx, impacting various cellular processes such as T-cell activation, cytokine production, and inflammation. This compound has shown potential for use in autoimmune diseases and inflammatory conditions, where excessive immune activation is a concern. piCRAC-1 is a valuable tool for research focused on modulating immune responses and developing targeted therapies for immune-related disorders.
| CAS Number | 2418049-54-2 |
| Synonyms | (2,6-difluorophenyl)-[1-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl]pyrazol-3-yl]diazene |
| Molecular Formula | C17H10F6N4 |
| Purity | ≥95% |
| IUPAC Name | (2,6-difluorophenyl)-[1-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl]pyrazol-3-yl]diazene |
| InChI | InChI=1S/C17H10F6N4/c18-12-4-1-3-11(17(21,22)23)10(12)9-27-8-7-15(26-27)24-25-16-13(19)5-2-6-14(16)20/h1-8H,9H2 |
| InChIKey | TXWNZTPRPAPHSE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)CN2C=CC(=N2)N=NC3=C(C=CC=C3F)F)C(F)(F)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
