For research use only. Not for therapeutic Use.
Picolinaldehyde, 2-pyridylhydrazone(CAT: L000381) is a chemical compound with relevance in organic chemistry. This compound serves as a valuable building block for the synthesis of various organic molecules, often used in the development of ligands, catalysts, or other specialty chemicals. Its structure containing a pyridylhydrazone group makes it a versatile intermediate in the creation of compounds with specific properties.
CAS Number | 2215-33-0 |
Molecular Formula | C11H10N4 |
Purity | ≥95% |
IUPAC Name | N-[(E)-pyridin-2-ylmethylideneamino]pyridin-2-amine |
InChI | InChI=1S/C11H10N4/c1-3-7-12-10(5-1)9-14-15-11-6-2-4-8-13-11/h1-9H,(H,13,15)/b14-9+ |
InChIKey | KYDLWVBNCQERCD-NTEUORMPSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |