For research use only. Not for therapeutic Use.
PI5P4Ks-IN-2(Cat No.:I041152)is a selective small molecule inhibitor targeting the enzyme PI5P4Ks (phosphatidylinositol 5-phosphate 4-kinases), which are involved in the regulation of lipid signaling and cellular functions such as growth, migration, and metabolism. By inhibiting PI5P4Ks, this compound modulates phosphoinositide metabolism, affecting cellular signaling pathways linked to cancer, neurodegenerative diseases, and immune responses. PI5P4Ks-IN-2 is being investigated for its therapeutic potential in conditions where dysregulated lipid signaling contributes to disease progression, offering a novel approach to modulating cellular pathways for therapeutic interventions.
| CAS Number | 2766854-03-7 |
| Synonyms | 5-methyl-2-(2-propan-2-ylphenyl)-N-(pyridin-2-ylmethyl)pyrrolo[3,2-d]pyrimidin-4-amine |
| Molecular Formula | C22H23N5 |
| Purity | ≥95% |
| IUPAC Name | 5-methyl-2-(2-propan-2-ylphenyl)-N-(pyridin-2-ylmethyl)pyrrolo[3,2-d]pyrimidin-4-amine |
| InChI | InChI=1S/C22H23N5/c1-15(2)17-9-4-5-10-18(17)21-25-19-11-13-27(3)20(19)22(26-21)24-14-16-8-6-7-12-23-16/h4-13,15H,14H2,1-3H3,(H,24,25,26) |
| InChIKey | XIEZMAUGHWKZDR-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=CC=C1C2=NC3=C(C(=N2)NCC4=CC=CC=N4)N(C=C3)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |