For research use only. Not for therapeutic Use.
PI3K-IN-36(Cat No.:I042617)is a selective inhibitor of the phosphoinositide 3-kinase (PI3K) pathway, which plays a crucial role in regulating various cellular processes such as cell growth, survival, metabolism, and immune response. By inhibiting PI3K, PI3K-IN-36 aims to disrupt aberrant signaling associated with diseases like cancer, autoimmune disorders, and metabolic diseases. This compound specifically targets PI3K’s lipid kinase activity, potentially preventing cancer cell proliferation and metastasis. Ongoing research is evaluating its effectiveness in preclinical and clinical studies, exploring its potential as a therapeutic agent in treating PI3K-driven cancers and other pathologies.
| CAS Number | 1401436-93-8 |
| Synonyms | 4-[2-(difluoromethyl)benzimidazol-1-yl]-N-[2-methyl-1-(2-piperidin-4-ylphenyl)propan-2-yl]-6-morpholin-4-yl-1,3,5-triazin-2-amine |
| Molecular Formula | C30H36F2N8O |
| Purity | ≥95% |
| IUPAC Name | 4-[2-(difluoromethyl)benzimidazol-1-yl]-N-[2-methyl-1-(2-piperidin-4-ylphenyl)propan-2-yl]-6-morpholin-4-yl-1,3,5-triazin-2-amine |
| InChI | InChI=1S/C30H36F2N8O/c1-30(2,19-21-7-3-4-8-22(21)20-11-13-33-14-12-20)38-27-35-28(39-15-17-41-18-16-39)37-29(36-27)40-24-10-6-5-9-23(24)34-26(40)25(31)32/h3-10,20,25,33H,11-19H2,1-2H3,(H,35,36,37,38) |
| InChIKey | YLLUIILPJZBRRN-UHFFFAOYSA-N |
| SMILES | CC(C)(CC1=CC=CC=C1C2CCNCC2)NC3=NC(=NC(=N3)N4CCOCC4)N5C6=CC=CC=C6N=C5C(F)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |