For research use only. Not for therapeutic Use.
PI3K/AKT-IN-2(Cat No.:I043653)is a selective inhibitor targeting the PI3K/AKT signaling pathway, a crucial regulator of cell growth, survival, and metabolism. By inhibiting PI3K and AKT, this compound disrupts the downstream signaling involved in tumorigenesis and cancer cell survival. It has shown potential in preclinical studies as a therapeutic agent for treating cancers with aberrant PI3K/AKT pathway activation, such as breast, prostate, and lung cancers. PI3K/AKT-IN-2 serves as a valuable tool in cancer research, helping to explore targeted therapies aimed at inhibiting this pathway to improve patient outcomes.
| CAS Number | 2684412-41-5 |
| Synonyms | [(5R,5aR,8aR,9R)-8-oxo-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl] (E)-4-(4-bromophenyl)-4-oxobut-2-enoate |
| Molecular Formula | C32H27BrO10 |
| Purity | ≥95% |
| IUPAC Name | [(5R,5aR,8aR,9R)-8-oxo-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl] (E)-4-(4-bromophenyl)-4-oxobut-2-enoate |
| InChI | InChI=1S/C32H27BrO10/c1-37-25-10-17(11-26(38-2)31(25)39-3)28-19-12-23-24(42-15-41-23)13-20(19)30(21-14-40-32(36)29(21)28)43-27(35)9-8-22(34)16-4-6-18(33)7-5-16/h4-13,21,28-30H,14-15H2,1-3H3/b9-8+/t21-,28+,29-,30-/m0/s1 |
| InChIKey | IKTFRKYEGUKRPW-NHMJTRFWSA-N |
| SMILES | COC1=CC(=CC(=C1OC)OC)[C@H]2[C@@H]3[C@H](COC3=O)[C@H](C4=CC5=C(C=C24)OCO5)OC(=O)/C=C/C(=O)C6=CC=C(C=C6)Br |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |