For research use only. Not for therapeutic Use.
Phthalic Anhydride (Cat.No:R039943) is a white crystalline compound commonly used in the production of plasticizers, resins, and dyes. It serves as a key ingredient in the synthesis of phthalate esters, which are widely employed in plastics manufacturing. Additionally, it finds application in coatings, pharmaceuticals, and as a chemical intermediate in various industries.
| CAS Number | 85-44-9 |
| Synonyms | 1,3-Isobenzofurandione; 1,2-Benzenedicarboxylic anhydride; 1,3-Phthalandione; 2-Benzofuran-1,3-dione; Araldite HT 901; ESEN; HT 901; NSC 10431; Phthalandione; Phthalanhydride; Phthalic acid anhydride; Retarder AK; Retarder B-C; Retarder ESEN; Retarde |
| Molecular Formula | C8H4O3 |
| Purity | ≥95% |
| Storage | 2°C to 8°C |
| IUPAC Name | 2-benzofuran-1,3-dione |
| InChI | InChI=1S/C8H4O3/c9-7-5-3-1-2-4-6(5)8(10)11-7/h1-4H |
| InChIKey | LGRFSURHDFAFJT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)OC2=O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |