For research use only. Not for therapeutic Use.
Phosphorous acid (Cat.No:M054619) is an inorganic compound used in various industrial applications. It serves as a precursor in the production of phosphonates, a class of compounds with diverse uses, including as scale and corrosion inhibitors, flame retardants, and in agriculture for plant nutrition. Phosphorous acid is also employed in chemical synthesis.
| CAS Number | 10294-56-1 |
| Molecular Formula | H3PO3 |
| Purity | ≥95% |
| Storage | Store at -20°C |
| IUPAC Name | phosphorous acid |
| InChI | InChI=1S/H3O3P/c1-4(2)3/h1-3H |
| InChIKey | OJMIONKXNSYLSR-UHFFFAOYSA-N |
| SMILES | OP(O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
