For research use only. Not for therapeutic Use.
Phenylacetylurea (CAS 63-98-9), also known as <span style="font-family:arial,helvetica,sans-serif;"><span style="font-size:12px;"><span style="font-variant-ligatures: normal; orphans: 2; widows: 2;">phenacemide, </span><span style="font-variant-ligatures: normal; orphans: 2; widows: 2;">is used to control certain seizures in the treatment of epilepsy. This medicine acts on the central nervous system (CNS) to reduce the number and severity of seizures.</span></span></span>
| CAS Number | 63-98-9 |
| Synonyms | LABOTEST-BB LT00455073;PHENURONE;PHENYLACETYLUREA;PHENACEMIDE;PHENACETYLUREA;(phenylacetyl)-ure;A-1348;Acetylureum; |
| Molecular Formula | C9H10N2O2 |
| Purity | ≥95% |
| Storage | Store at -20C |
| IUPAC Name | N-carbamoyl-2-phenylacetamide |
| InChI | InChI=1S/C9H10N2O2/c10-9(13)11-8(12)6-7-4-2-1-3-5-7/h1-5H,6H2,(H3,10,11,12,13) |
| InChIKey | XPFRXWCVYUEORT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(=O)NC(=O)N |
| Reference | 1: Semikolennykh LM, Katsnel/'son MG, Del/'nik VB. [The synthesis of phenylacetylurea]. Med Prom SSSR. 1965 Oct;19(10):15-7. Russian. PubMed PMID: 5872861.<br /> |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |