For research use only. Not for therapeutic Use.
Phenyl Ether (CAT: R056774) is an aromatic ether composed of two phenyl rings linked by an oxygen atom, offering thermal stability and chemical inertness. It is commonly used as a high-boiling solvent, heat-transfer medium, and starting material in organic synthesis. In research settings, Phenyl Ether serves as a precursor for functionalized aromatic compounds and is valuable in studies of aromatic substitution reactions. It also finds relevance in polymer science and materials chemistry due to its structural rigidity and resistance to degradation.
| CAS Number | 101-84-8 |
| Synonyms | 1,1’-Oxybisbenzene; 1,1’-Oxybis[benzene]; Barrel Therm 330; Phenoxybenzene; Biphenyl Oxide; Chemcryl JK-EB; Diphenyl Ether; Diphenyl Oxide; NSC 19311; Oxybisbenzene; Phenoxybenzene; Phenyl Oxide; |
| Molecular Formula | C12H10O |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | phenoxybenzene |
| InChI | InChI=1S/C12H10O/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1-10H |
| InChIKey | USIUVYZYUHIAEV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=CC=C2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
