For research use only. Not for therapeutic Use.
Phenoxazine (Cat No.: M071847) is a tricyclic heterocyclic compound composed of two benzene rings fused to a central oxazine ring containing both nitrogen and oxygen atoms. This aromatic molecule forms the structural backbone of various dyes, such as Nile Blue and Cresyl Violet, known for their vivid colors and fluorescence. Phenoxazine derivatives are widely used in textiles, biological staining, and fluorescence microscopy. Additionally, they are studied for their potential in organic electronics, redox-active materials, and pharmaceutical applications due to their stable conjugated system.
| CAS Number | 135-67-1 |
| Molecular Formula | C12H9NO |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 10H-phenoxazine |
| InChI | InChI=1S/C12H9NO/c1-3-7-11-9(5-1)13-10-6-2-4-8-12(10)14-11/h1-8,13H |
| InChIKey | TZMSYXZUNZXBOL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC3=CC=CC=C3O2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
