For research use only. Not for therapeutic Use.
Phaseoloidin(Cat No.:I044915)is a naturally occurring flavonoid, specifically a pterocarpan derivative, isolated from legumes such as Phaseolus and Erythrina species. It exhibits a broad spectrum of biological activities, including antimicrobial, antioxidant, and anti-inflammatory effects. Phaseoloidin is particularly noted for its role in plant defense mechanisms and is being investigated for its potential in treating infectious diseases and oxidative stress-related conditions. Its polyphenolic structure contributes to its radical-scavenging capacity and enzyme modulation. As a plant-derived compound, Phaseoloidin holds promise in natural product research and the development of therapeutic agents.
CAS Number | 118555-82-1 |
Synonyms | 2-[5-hydroxy-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]acetic acid |
Molecular Formula | C14H18O9 |
Purity | ≥95% |
IUPAC Name | 2-[5-hydroxy-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]acetic acid |
InChI | InChI=1S/C14H18O9/c15-5-9-11(19)12(20)13(21)14(23-9)22-8-2-1-7(16)3-6(8)4-10(17)18/h1-3,9,11-16,19-21H,4-5H2,(H,17,18)/t9-,11-,12+,13-,14-/m1/s1 |
InChIKey | MVFYXXNAFZRZAM-RGCYKPLRSA-N |
SMILES | C1=CC(=C(C=C1O)CC(=O)O)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |