For research use only. Not for therapeutic Use.
PHA 408（Cat No.:I034559）is a potent peptide inhibitor designed to target specific cellular pathways, making it a valuable tool for research in cancer and metabolic diseases. Its mechanism of action involves inhibiting key enzymes involved in cell signaling, potentially reducing abnormal cell proliferation and inflammation. This peptide’s high specificity and efficacy make it suitable for exploring therapeutic strategies in oncology and metabolic disorders. PHA 408 is provided with high purity, making it an essential reagent for researchers studying disease mechanisms and potential treatment targets.
| CAS Number | 503555-55-3 |
| Synonyms | 8-[[5-chloro-2-(4-methylpiperazin-1-yl)pyridine-4-carbonyl]amino]-1-(4-fluorophenyl)-4,5-dihydrobenzo[g]indazole-3-carboxamide |
| Molecular Formula | C29H27ClFN7O2 |
| Purity | ≥95% |
| IUPAC Name | 8-[[5-chloro-2-(4-methylpiperazin-1-yl)pyridine-4-carbonyl]amino]-1-(4-fluorophenyl)-4,5-dihydrobenzo[g]indazole-3-carboxamide |
| InChI | InChI=1S/C29H27ClFN7O2/c1-36-10-12-37(13-11-36)25-15-23(24(30)16-33-25)29(40)34-19-6-2-17-3-9-21-26(28(32)39)35-38(27(21)22(17)14-19)20-7-4-18(31)5-8-20/h2,4-8,14-16H,3,9-13H2,1H3,(H2,32,39)(H,34,40) |
| InChIKey | ZLEZHGHFWIHCGU-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=NC=C(C(=C2)C(=O)NC3=CC4=C(CCC5=C4N(N=C5C(=O)N)C6=CC=C(C=C6)F)C=C3)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
