For research use only. Not for therapeutic Use.
PH14(CAT: I040305) is a dual inhibitor targeting phosphoinositide 3-kinase alpha (PI3Kα) and histone deacetylase 3 (HDAC3), with IC₅₀ values of 20.3 nM and 24.5 nM, respectively. This compound combines epigenetic and signaling pathway modulation, offering synergistic anticancer effects. PH14 exhibits potent antiproliferative activity and effectively induces apoptosis in Jeko-1 lymphoma cells, making it a promising candidate for hematologic malignancy research. By concurrently inhibiting PI3K and HDAC pathways, PH14 disrupts cell survival signaling and chromatin remodeling, providing a multifaceted approach to tumor suppression.
| Synonyms | N-[6-(2-aminoanilino)-6-oxohexyl]-4-[[4-(4-methoxy-6-morpholin-4-yl-1,3,5-triazin-2-yl)phenyl]carbamoylamino]benzamide |
| Molecular Formula | C34H39N9O5 |
| Purity | ≥95% |
| IUPAC Name | N-[6-(2-aminoanilino)-6-oxohexyl]-4-[[4-(4-methoxy-6-morpholin-4-yl-1,3,5-triazin-2-yl)phenyl]carbamoylamino]benzamide |
| InChI | InChI=1S/C34H39N9O5/c1-47-34-41-30(40-32(42-34)43-19-21-48-22-20-43)23-10-14-25(15-11-23)37-33(46)38-26-16-12-24(13-17-26)31(45)36-18-6-2-3-9-29(44)39-28-8-5-4-7-27(28)35/h4-5,7-8,10-17H,2-3,6,9,18-22,35H2,1H3,(H,36,45)(H,39,44)(H2,37,38,46) |
| InChIKey | AIKJBINJGKQOJL-UHFFFAOYSA-N |
| SMILES | COC1=NC(=NC(=N1)N2CCOCC2)C3=CC=C(C=C3)NC(=O)NC4=CC=C(C=C4)C(=O)NCCCCCC(=O)NC5=CC=CC=C5N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
