For research use only. Not for therapeutic Use.
PGP-4008（Cat No.:I008722）is a selective inhibitor of P-glycoprotein (P-gp), a membrane transport protein involved in drug efflux, which plays a significant role in multidrug resistance (MDR) in cancer cells. By inhibiting P-gp, PGP-4008 helps to increase the intracellular accumulation of chemotherapy drugs, enhancing their effectiveness against resistant tumor cells. This compound has potential applications in overcoming drug resistance in cancers such as leukemia, breast cancer, and lung cancer. PGP-4008 is an important tool in cancer research, supporting the development of therapies aimed at reversing MDR and improving chemotherapy outcomes.
| CAS Number | 365565-02-2 |
| Synonyms | N-(1-benzyl-2,3-dihydropyrrolo[2,3-b]quinolin-4-yl)-2-phenylacetamide |
| Molecular Formula | C26H23N3O |
| Purity | ≥95% |
| IUPAC Name | N-(1-benzyl-2,3-dihydropyrrolo[2,3-b]quinolin-4-yl)-2-phenylacetamide |
| InChI | InChI=1S/C26H23N3O/c30-24(17-19-9-3-1-4-10-19)28-25-21-13-7-8-14-23(21)27-26-22(25)15-16-29(26)18-20-11-5-2-6-12-20/h1-14H,15-18H2,(H,27,28,30) |
| InChIKey | HVIAKQBMYMKWII-UHFFFAOYSA-N |
| SMILES | C1CN(C2=NC3=CC=CC=C3C(=C21)NC(=O)CC4=CC=CC=C4)CC5=CC=CC=C5 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
